About 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione
2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione (PubChem CID 175173145) has the molecular formula C14H27N3O8
and a molecular weight of 365.38 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione |
| PubChem CID | 175173145 |
| Molecular Formula | C14H27N3O8 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione |
| SMILES | O=C(O)CN(CCO)CCO.O=C1CN(CCO)C(=O)CN1CCO |
| InChI | InChI=1S/C8H14N2O4.C6H13NO4/c11-3-1-9-5-8(14)10(2-4-12)6-7(9)13;8-3-1-7(2-4-9)5-6(10)11/h11-12H,1-6H2;8-9H,1-5H2,(H,10,11) |
| InChIKey | ZWTREQPUYQBOKG-UHFFFAOYSA-N |
| XLogP | -4.00 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione (CID 175173145) is 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione is O=C(O)CN(CCO)CCO.O=C1CN(CCO)C(=O)CN1CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione?
The InChIKey is ZWTREQPUYQBOKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4.C6H13NO4/c11-3-1-9-5-8(14)10(2-4-12)6-7(9)13;8-3-1-7(2-4-9)5-6(10)11/h11-12H,1-6H2;8-9H,1-5H2,(H,10,11).
What are the key properties of 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione?
2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione has a molecular weight of 365.38 g/mol, XLogP of -4.00, 10 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]acetic acid;1,4-bis(2-hydroxyethyl)piperazine-2,5-dione is sourced from PubChem (CID 175173145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).