About octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate
octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 175173412) has the molecular formula C24H31FO5S
and a molecular weight of 450.57 g/mol. Its IUPAC name is octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate.
Molecular Properties
| Compound Name | octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate |
| PubChem CID | 175173412 |
| Molecular Formula | C24H31FO5S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | CCCCCC(CC)OC(=O)C(COS(=O)(=O)c1ccc(C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H31FO5S/c1-4-6-7-8-21(5-2)30-24(26)23(19-11-13-20(25)14-12-19)17-29-31(27,28)22-15-9-18(3)10-16-22/h9-16,21,23H,4-8,17H2,1-3H3 |
| InChIKey | PZHFVBBJAODUSJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate?
The IUPAC name of octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate (CID 175173412) is octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate.
What is the SMILES notation for octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate?
The canonical SMILES for octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate is CCCCCC(CC)OC(=O)C(COS(=O)(=O)c1ccc(C)cc1)c1ccc(F)cc1.
What is the InChIKey of octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate?
The InChIKey is PZHFVBBJAODUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31FO5S/c1-4-6-7-8-21(5-2)30-24(26)23(19-11-13-20(25)14-12-19)17-29-31(27,28)22-15-9-18(3)10-16-22/h9-16,21,23H,4-8,17H2,1-3H3.
What are the key properties of octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate?
octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate has a molecular weight of 450.57 g/mol, XLogP of 5.53, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for octan-3-yl 2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonyloxypropanoate is sourced from PubChem (CID 175173412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).