About [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate
[2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate (PubChem CID 175174385) has the molecular formula C10H15Cl2N3O3S
and a molecular weight of 328.22 g/mol. Its IUPAC name is [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate.
Molecular Properties
| Compound Name | [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate |
| PubChem CID | 175174385 |
| Molecular Formula | C10H15Cl2N3O3S |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1c(Cl)nc(Cl)nc1NC(C)C |
| InChI | InChI=1S/C10H15Cl2N3O3S/c1-4-5-19(16,17)18-7-8(11)14-10(12)15-9(7)13-6(2)3/h6H,4-5H2,1-3H3,(H,13,14,15) |
| InChIKey | NJYUPLQVIWEJKP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate?
The IUPAC name of [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate (CID 175174385) is [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate.
What is the SMILES notation for [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate?
The canonical SMILES for [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate is CCCS(=O)(=O)Oc1c(Cl)nc(Cl)nc1NC(C)C.
What is the InChIKey of [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate?
The InChIKey is NJYUPLQVIWEJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Cl2N3O3S/c1-4-5-19(16,17)18-7-8(11)14-10(12)15-9(7)13-6(2)3/h6H,4-5H2,1-3H3,(H,13,14,15).
What are the key properties of [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate?
[2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate has a molecular weight of 328.22 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dichloro-6-(propan-2-ylamino)pyrimidin-5-yl] propane-1-sulfonate is sourced from PubChem (CID 175174385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).