C11H26N2O — CID 175174761
azane;1,4,5,5,6,6-hexamethylpiperidin-2-ol (PubChem CID 175174761) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is azane;1,4,5,5,6,6-hexamethylpiperidin-2-ol.
| Compound Name | azane;1,4,5,5,6,6-hexamethylpiperidin-2-ol |
|---|---|
| PubChem CID | 175174761 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | azane;1,4,5,5,6,6-hexamethylpiperidin-2-ol |
| SMILES | CC1CC(O)N(C)C(C)(C)C1(C)C.N |
| InChI | InChI=1S/C11H23NO.H3N/c1-8-7-9(13)12(6)11(4,5)10(8,2)3;/h8-9,13H,7H2,1-6H3;1H3 |
| InChIKey | HZGNGIWBYLCHIN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |