C34H34N3O3+ — CID 175174947
9-methyl-1-(3,4,5-trimethoxyphenyl)-3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole (PubChem CID 175174947) has the molecular formula C34H34N3O3+ and a molecular weight of 532.66 g/mol. Its IUPAC name is 9-methyl-1-(3,4,5-trimethoxyphenyl)-3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole.
| Compound Name | 9-methyl-1-(3,4,5-trimethoxyphenyl)-3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 175174947 |
| Molecular Formula | C34H34N3O3+ |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 9-methyl-1-(3,4,5-trimethoxyphenyl)-3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]pyrido[3,4-b]indole |
| SMILES | COc1cc(-c2nc(/C=C\C3=[N+](C)c4ccccc4C3(C)C)cc3c4ccccc4n(C)c23)cc(OC)c1OC |
| InChI | InChI=1S/C34H34N3O3/c1-34(2)25-13-9-11-15-27(25)36(3)30(34)17-16-22-20-24-23-12-8-10-14-26(23)37(4)32(24)31(35-22)21-18-28(38-5)33(40-7)29(19-21)39-6/h8-20H,1-7H3/q+1 |
| InChIKey | QWXXJWBRIXDLHL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|