About 1,3-dioxol-2-one;1H-phenalene
1,3-dioxol-2-one;1H-phenalene (PubChem CID 175175207) has the molecular formula C16H12O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is 1,3-dioxol-2-one;1H-phenalene.
Molecular Properties
| Compound Name | 1,3-dioxol-2-one;1H-phenalene |
| PubChem CID | 175175207 |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1,3-dioxol-2-one;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.O=c1occo1 |
| InChI | InChI=1S/C13H10.C3H2O3/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;4-3-5-1-2-6-3/h1-8H,9H2;1-2H |
| InChIKey | MNBIOMHPNDXDSS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dioxol-2-one;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxol-2-one;1H-phenalene?
The IUPAC name of 1,3-dioxol-2-one;1H-phenalene (CID 175175207) is 1,3-dioxol-2-one;1H-phenalene.
What is the SMILES notation for 1,3-dioxol-2-one;1H-phenalene?
The canonical SMILES for 1,3-dioxol-2-one;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.O=c1occo1.
What is the InChIKey of 1,3-dioxol-2-one;1H-phenalene?
The InChIKey is MNBIOMHPNDXDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C3H2O3/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;4-3-5-1-2-6-3/h1-8H,9H2;1-2H.
What are the key properties of 1,3-dioxol-2-one;1H-phenalene?
1,3-dioxol-2-one;1H-phenalene has a molecular weight of 252.27 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxol-2-one;1H-phenalene is sourced from PubChem (CID 175175207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).