About 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one
3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one (PubChem CID 175175390) has the molecular formula C19H27NO2S2
and a molecular weight of 365.56 g/mol. Its IUPAC name is 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one.
Molecular Properties
| Compound Name | 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one |
| PubChem CID | 175175390 |
| Molecular Formula | C19H27NO2S2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one |
| SMILES | CCCC(S)C(CS)c1cc2ccc(N(CC)CC)cc2oc1=O |
| InChI | InChI=1S/C19H27NO2S2/c1-4-7-18(24)16(12-23)15-10-13-8-9-14(20(5-2)6-3)11-17(13)22-19(15)21/h8-11,16,18,23-24H,4-7,12H2,1-3H3 |
| InChIKey | VPBPDENGBLVQLZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 33.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one?
The IUPAC name of 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one (CID 175175390) is 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one.
What is the SMILES notation for 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one?
The canonical SMILES for 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one is CCCC(S)C(CS)c1cc2ccc(N(CC)CC)cc2oc1=O.
What is the InChIKey of 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one?
The InChIKey is VPBPDENGBLVQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO2S2/c1-4-7-18(24)16(12-23)15-10-13-8-9-14(20(5-2)6-3)11-17(13)22-19(15)21/h8-11,16,18,23-24H,4-7,12H2,1-3H3.
What are the key properties of 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one?
3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one has a molecular weight of 365.56 g/mol, XLogP of 4.75, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-bis(sulfanyl)hexan-2-yl]-7-(diethylamino)chromen-2-one is sourced from PubChem (CID 175175390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).