C22H35NO3Si — CID 175176665
2-[(1S,3R,5R)-8-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octan-3-yl]acetic acid (PubChem CID 175176665) has the molecular formula C22H35NO3Si and a molecular weight of 389.61 g/mol. Its IUPAC name is 2-[(1S,3R,5R)-8-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octan-3-yl]acetic acid.
| Compound Name | 2-[(1S,3R,5R)-8-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
|---|---|
| PubChem CID | 175176665 |
| Molecular Formula | C22H35NO3Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 2-[(1S,3R,5R)-8-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@@H]2C[C@@H](CC(=O)O)C[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C22H35NO3Si/c1-22(2,3)27(4,5)26-20-14-18-11-17(13-21(24)25)12-19(20)23(18)15-16-9-7-6-8-10-16/h6-10,17-20H,11-15H2,1-5H3,(H,24,25)/t17-,18+,19-,20?/m1/s1 |
| InChIKey | PTTZRHXFKWRZTD-BMHONFFRSA-N |
| XLogP | 4.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|