About 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one
1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one (PubChem CID 175177427) has the molecular formula C17H24N2O5
and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one.
Molecular Properties
| Compound Name | 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one |
| PubChem CID | 175177427 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one |
| SMILES | CCCCN1CC([N+](=O)[O-])C(c2ccc(OC)c(OC)c2)CC1=O |
| InChI | InChI=1S/C17H24N2O5/c1-4-5-8-18-11-14(19(21)22)13(10-17(18)20)12-6-7-15(23-2)16(9-12)24-3/h6-7,9,13-14H,4-5,8,10-11H2,1-3H3 |
| InChIKey | CVNUJOVANWCIOT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one?
The IUPAC name of 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one (CID 175177427) is 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one.
What is the SMILES notation for 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one?
The canonical SMILES for 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one is CCCCN1CC([N+](=O)[O-])C(c2ccc(OC)c(OC)c2)CC1=O.
What is the InChIKey of 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one?
The InChIKey is CVNUJOVANWCIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O5/c1-4-5-8-18-11-14(19(21)22)13(10-17(18)20)12-6-7-15(23-2)16(9-12)24-3/h6-7,9,13-14H,4-5,8,10-11H2,1-3H3.
What are the key properties of 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one?
1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one has a molecular weight of 336.39 g/mol, XLogP of 2.47, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-(3,4-dimethoxyphenyl)-5-nitropiperidin-2-one is sourced from PubChem (CID 175177427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).