About 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride
1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride (PubChem CID 175177485) has the molecular formula C20H27Cl3N2
and a molecular weight of 401.81 g/mol. Its IUPAC name is 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride |
| PubChem CID | 175177485 |
| Molecular Formula | C20H27Cl3N2 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride |
| SMILES | Cl.Cl.ClCCCC(c1ccccc1)(c1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C20H25ClN2.2ClH/c21-13-7-12-20(18-8-3-1-4-9-18,19-10-5-2-6-11-19)23-16-14-22-15-17-23;;/h1-6,8-11,22H,7,12-17H2;2*1H |
| InChIKey | URNHPSBWCFWEIU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride?
The IUPAC name of 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride (CID 175177485) is 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride.
What is the SMILES notation for 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride?
The canonical SMILES for 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride is Cl.Cl.ClCCCC(c1ccccc1)(c1ccccc1)N1CCNCC1.
What is the InChIKey of 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride?
The InChIKey is URNHPSBWCFWEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25ClN2.2ClH/c21-13-7-12-20(18-8-3-1-4-9-18,19-10-5-2-6-11-19)23-16-14-22-15-17-23;;/h1-6,8-11,22H,7,12-17H2;2*1H.
What are the key properties of 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride?
1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride has a molecular weight of 401.81 g/mol, XLogP of 4.70, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1,1-diphenylbutyl)piperazine;dihydrochloride is sourced from PubChem (CID 175177485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).