About [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate
[6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate (PubChem CID 175177585) has the molecular formula C13H15F3O3
and a molecular weight of 276.25 g/mol. Its IUPAC name is [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate.
Molecular Properties
| Compound Name | [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate |
| PubChem CID | 175177585 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1(C(F)(F)F)C=CC=CC1=O |
| InChI | InChI=1S/C13H15F3O3/c1-2-3-4-8-11(18)19-12(13(14,15)16)9-6-5-7-10(12)17/h5-7,9H,2-4,8H2,1H3 |
| InChIKey | FZDXABPGRFQHRP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate?
The IUPAC name of [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate (CID 175177585) is [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate.
What is the SMILES notation for [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate?
The canonical SMILES for [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate is CCCCCC(=O)OC1(C(F)(F)F)C=CC=CC1=O.
What is the InChIKey of [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate?
The InChIKey is FZDXABPGRFQHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O3/c1-2-3-4-8-11(18)19-12(13(14,15)16)9-6-5-7-10(12)17/h5-7,9H,2-4,8H2,1H3.
What are the key properties of [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate?
[6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate has a molecular weight of 276.25 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-oxo-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl] hexanoate is sourced from PubChem (CID 175177585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).