About [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate
[2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate (PubChem CID 175177586) has the molecular formula C17H23FN2O4
and a molecular weight of 338.38 g/mol. Its IUPAC name is [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate.
Molecular Properties
| Compound Name | [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate |
| PubChem CID | 175177586 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate |
| SMILES | CC(=O)Oc1cc([N+](=O)[O-])c(NC2CC(C)CC(C)(C)C2)cc1F |
| InChI | InChI=1S/C17H23FN2O4/c1-10-5-12(9-17(3,4)8-10)19-14-6-13(18)16(24-11(2)21)7-15(14)20(22)23/h6-7,10,12,19H,5,8-9H2,1-4H3 |
| InChIKey | VSOVLTWRLQECGR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate?
The IUPAC name of [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate (CID 175177586) is [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate.
What is the SMILES notation for [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate?
The canonical SMILES for [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate is CC(=O)Oc1cc([N+](=O)[O-])c(NC2CC(C)CC(C)(C)C2)cc1F.
What is the InChIKey of [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate?
The InChIKey is VSOVLTWRLQECGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FN2O4/c1-10-5-12(9-17(3,4)8-10)19-14-6-13(18)16(24-11(2)21)7-15(14)20(22)23/h6-7,10,12,19H,5,8-9H2,1-4H3.
What are the key properties of [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate?
[2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate has a molecular weight of 338.38 g/mol, XLogP of 4.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate is sourced from PubChem (CID 175177586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).