About ethanamine;5-fluoro-1H-indole
ethanamine;5-fluoro-1H-indole (PubChem CID 175177872) has the molecular formula C10H13FN2
and a molecular weight of 180.23 g/mol. Its IUPAC name is ethanamine;5-fluoro-1H-indole.
Molecular Properties
| Compound Name | ethanamine;5-fluoro-1H-indole |
| PubChem CID | 175177872 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | ethanamine;5-fluoro-1H-indole |
| SMILES | CCN.Fc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H6FN.C2H7N/c9-7-1-2-8-6(5-7)3-4-10-8;1-2-3/h1-5,10H;2-3H2,1H3 |
| InChIKey | SUXWOCKNMURNIS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanamine;5-fluoro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;5-fluoro-1H-indole?
The IUPAC name of ethanamine;5-fluoro-1H-indole (CID 175177872) is ethanamine;5-fluoro-1H-indole.
What is the SMILES notation for ethanamine;5-fluoro-1H-indole?
The canonical SMILES for ethanamine;5-fluoro-1H-indole is CCN.Fc1ccc2[nH]ccc2c1.
What is the InChIKey of ethanamine;5-fluoro-1H-indole?
The InChIKey is SUXWOCKNMURNIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN.C2H7N/c9-7-1-2-8-6(5-7)3-4-10-8;1-2-3/h1-5,10H;2-3H2,1H3.
What are the key properties of ethanamine;5-fluoro-1H-indole?
ethanamine;5-fluoro-1H-indole has a molecular weight of 180.23 g/mol, XLogP of 2.27, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;5-fluoro-1H-indole is sourced from PubChem (CID 175177872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).