C15H28Cl2N4O3S — CID 175178080
8,8-dimethyl-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide;dihydrochloride (PubChem CID 175178080) has the molecular formula C15H28Cl2N4O3S and a molecular weight of 415.39 g/mol. Its IUPAC name is 8,8-dimethyl-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide;dihydrochloride.
| Compound Name | 8,8-dimethyl-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 175178080 |
| Molecular Formula | C15H28Cl2N4O3S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 8,8-dimethyl-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide;dihydrochloride |
| SMILES | CN[C@@H](C)C(=O)NC1CCSC2CC(C)(C)C(C(N)=O)N2C1=O.Cl.Cl |
| InChI | InChI=1S/C15H26N4O3S.2ClH/c1-8(17-4)13(21)18-9-5-6-23-10-7-15(2,3)11(12(16)20)19(10)14(9)22;;/h8-11,17H,5-7H2,1-4H3,(H2,16,20)(H,18,21);2*1H/t8-,9?,10?,11?;;/m0../s1 |
| InChIKey | ZWHUNUGSZINCRX-VQPQTNRTSA-N |
| XLogP | 0.50 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |