About (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine
(3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine (PubChem CID 175178128) has the molecular formula C8H12F2N4
and a molecular weight of 202.21 g/mol. Its IUPAC name is (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine |
| PubChem CID | 175178128 |
| Molecular Formula | C8H12F2N4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine |
| SMILES | N[C@H]1CN(c2ccn[nH]2)CC(F)(F)C1 |
| InChI | InChI=1S/C8H12F2N4/c9-8(10)3-6(11)4-14(5-8)7-1-2-12-13-7/h1-2,6H,3-5,11H2,(H,12,13)/t6-/m1/s1 |
| InChIKey | MMNVEMPPHKRKAU-ZCFIWIBFSA-N |
| XLogP | 0.58 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine?
The IUPAC name of (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine (CID 175178128) is (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine.
What is the SMILES notation for (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine?
The canonical SMILES for (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine is N[C@H]1CN(c2ccn[nH]2)CC(F)(F)C1.
What is the InChIKey of (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine?
The InChIKey is MMNVEMPPHKRKAU-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H12F2N4/c9-8(10)3-6(11)4-14(5-8)7-1-2-12-13-7/h1-2,6H,3-5,11H2,(H,12,13)/t6-/m1/s1.
What are the key properties of (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine?
(3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine has a molecular weight of 202.21 g/mol, XLogP of 0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5,5-difluoro-1-(1H-pyrazol-5-yl)piperidin-3-amine is sourced from PubChem (CID 175178128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).