C31H41F2N3O4Si — CID 175178505
tert-butyl-[5-[3,5-difluoro-4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoxy]-dimethylsilane (PubChem CID 175178505) has the molecular formula C31H41F2N3O4Si and a molecular weight of 585.77 g/mol. Its IUPAC name is tert-butyl-[5-[3,5-difluoro-4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[5-[3,5-difluoro-4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 175178505 |
| Molecular Formula | C31H41F2N3O4Si |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | tert-butyl-[5-[3,5-difluoro-4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoxy]-dimethylsilane |
| SMILES | CC(OC1CCCCO1)c1nccn1Cc1cc(-c2c(F)cc(C#CCCCO[Si](C)(C)C(C)(C)C)cc2F)on1 |
| InChI | InChI=1S/C31H41F2N3O4Si/c1-22(39-28-13-9-11-16-37-28)30-34-14-15-36(30)21-24-20-27(40-35-24)29-25(32)18-23(19-26(29)33)12-8-7-10-17-38-41(5,6)31(2,3)4/h14-15,18-20,22,28H,7,9-11,13,16-17,21H2,1-6H3 |
| InChIKey | CYPDSIGJEZWSMS-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 71.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|