C17H21F2NO4 — CID 175178682
(2S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carbaldehyde (PubChem CID 175178682) has the molecular formula C17H21F2NO4 and a molecular weight of 341.35 g/mol. Its IUPAC name is (2S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carbaldehyde.
| Compound Name | (2S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 175178682 |
| Molecular Formula | C17H21F2NO4 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carbaldehyde |
| SMILES | O=CN1CC(c2ccc(OC(F)F)c(OCC3CC3)c2)C[C@H]1CO |
| InChI | InChI=1S/C17H21F2NO4/c18-17(19)24-15-4-3-12(6-16(15)23-9-11-1-2-11)13-5-14(8-21)20(7-13)10-22/h3-4,6,10-11,13-14,17,21H,1-2,5,7-9H2/t13?,14-/m0/s1 |
| InChIKey | RCSPTNROJDMTOG-KZUDCZAMSA-N |
| XLogP | 2.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|