C9H8O4S — CID 175178848
2-prop-1-enylthiophene-3,4-dicarboxylic acid (PubChem CID 175178848) has the molecular formula C9H8O4S and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-prop-1-enylthiophene-3,4-dicarboxylic acid.
| Compound Name | 2-prop-1-enylthiophene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 175178848 |
| Molecular Formula | C9H8O4S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 2-prop-1-enylthiophene-3,4-dicarboxylic acid |
| SMILES | CC=Cc1scc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C9H8O4S/c1-2-3-6-7(9(12)13)5(4-14-6)8(10)11/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | CHWMXBYHNXFNHJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |