About 2-(triazin-4-yl)-1,8-naphthyridine
2-(triazin-4-yl)-1,8-naphthyridine (PubChem CID 175179815) has the molecular formula C11H7N5
and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-(triazin-4-yl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-(triazin-4-yl)-1,8-naphthyridine |
| PubChem CID | 175179815 |
| Molecular Formula | C11H7N5 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(triazin-4-yl)-1,8-naphthyridine |
| SMILES | c1cnc2nc(-c3ccnnn3)ccc2c1 |
| InChI | InChI=1S/C11H7N5/c1-2-8-3-4-9(14-11(8)12-6-1)10-5-7-13-16-15-10/h1-7H |
| InChIKey | BNFYIOIAPWTYAJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(triazin-4-yl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazin-4-yl)-1,8-naphthyridine?
The IUPAC name of 2-(triazin-4-yl)-1,8-naphthyridine (CID 175179815) is 2-(triazin-4-yl)-1,8-naphthyridine.
What is the SMILES notation for 2-(triazin-4-yl)-1,8-naphthyridine?
The canonical SMILES for 2-(triazin-4-yl)-1,8-naphthyridine is c1cnc2nc(-c3ccnnn3)ccc2c1.
What is the InChIKey of 2-(triazin-4-yl)-1,8-naphthyridine?
The InChIKey is BNFYIOIAPWTYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5/c1-2-8-3-4-9(14-11(8)12-6-1)10-5-7-13-16-15-10/h1-7H.
What are the key properties of 2-(triazin-4-yl)-1,8-naphthyridine?
2-(triazin-4-yl)-1,8-naphthyridine has a molecular weight of 209.21 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazin-4-yl)-1,8-naphthyridine is sourced from PubChem (CID 175179815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).