C17H15F21OSi — CID 175180201
6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2,2,6-trimethyloxasilinane (PubChem CID 175180201) has the molecular formula C17H15F21OSi and a molecular weight of 662.35 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2,2,6-trimethyloxasilinane.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2,2,6-trimethyloxasilinane |
|---|---|
| PubChem CID | 175180201 |
| Molecular Formula | C17H15F21OSi |
| Molecular Weight | 662.35 g/mol |
| Exact Mass | 662.06 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2,2,6-trimethyloxasilinane |
| SMILES | CC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC[Si](C)(C)O1 |
| InChI | InChI=1S/C17H15F21OSi/c1-7(5-4-6-40(2,3)39-7)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)16(34,35)17(36,37)38/h4-6H2,1-3H3 |
| InChIKey | WWKNXAXVNPRMPK-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.35 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|