1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid

C8H8N2O2 — CID 175180403

IUPAC1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid
SMILESO=C(O)C1=CNN2CC=CC=C12
InChIInChI=1S/C8H8N2O2/c11-8(12)6-5-9-10-4-2-1-3-7(6)10/h1-3,5,9H,4H2,(H,11,12)
InChIKeyMRDKDRRVCJTLAN-UHFFFAOYSA-N
MW164.16 g/mol
LogP0.23
Rot. Bonds1

About 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid

1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid (PubChem CID 175180403) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid
PubChem CID175180403
Molecular FormulaC8H8N2O2
Molecular Weight164.16 g/mol
Exact Mass164.06
IUPAC Name1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid
SMILESO=C(O)C1=CNN2CC=CC=C12
InChIInChI=1S/C8H8N2O2/c11-8(12)6-5-9-10-4-2-1-3-7(6)10/h1-3,5,9H,4H2,(H,11,12)
InChIKeyMRDKDRRVCJTLAN-UHFFFAOYSA-N
XLogP0.23
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.16
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid?
The IUPAC name of 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid (CID 175180403) is 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid.
What is the SMILES notation for 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid?
The canonical SMILES for 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid is O=C(O)C1=CNN2CC=CC=C12.
What is the InChIKey of 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid?
The InChIKey is MRDKDRRVCJTLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-8(12)6-5-9-10-4-2-1-3-7(6)10/h1-3,5,9H,4H2,(H,11,12).
What are the key properties of 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid?
1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid has a molecular weight of 164.16 g/mol, XLogP of 0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydropyrazolo[1,5-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 175180403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).