(2Z)-2-hydroxyiminoacetyl chloride

C2H2ClNO2 — CID 175180486

IUPAC(2Z)-2-hydroxyiminoacetyl chloride
SMILESO=C(Cl)/C=N\O
InChIInChI=1S/C2H2ClNO2/c3-2(5)1-4-6/h1,6H/b4-1-
InChIKeyKWFAKELABFNRJT-RJRFIUFISA-N
MW107.50 g/mol
LogP0.21
Rot. Bonds1

About (2Z)-2-hydroxyiminoacetyl chloride

(2Z)-2-hydroxyiminoacetyl chloride (PubChem CID 175180486) has the molecular formula C2H2ClNO2 and a molecular weight of 107.50 g/mol. Its IUPAC name is (2Z)-2-hydroxyiminoacetyl chloride.

Molecular Properties

Compound Name(2Z)-2-hydroxyiminoacetyl chloride
PubChem CID175180486
Molecular FormulaC2H2ClNO2
Molecular Weight107.50 g/mol
Exact Mass106.98
IUPAC Name(2Z)-2-hydroxyiminoacetyl chloride
SMILESO=C(Cl)/C=N\O
InChIInChI=1S/C2H2ClNO2/c3-2(5)1-4-6/h1,6H/b4-1-
InChIKeyKWFAKELABFNRJT-RJRFIUFISA-N
XLogP0.21
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500107.50
LogP ≤ 50.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2Z)-2-hydroxyiminoacetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z)-2-hydroxyiminoacetyl chloride?
The IUPAC name of (2Z)-2-hydroxyiminoacetyl chloride (CID 175180486) is (2Z)-2-hydroxyiminoacetyl chloride.
What is the SMILES notation for (2Z)-2-hydroxyiminoacetyl chloride?
The canonical SMILES for (2Z)-2-hydroxyiminoacetyl chloride is O=C(Cl)/C=N\O.
What is the InChIKey of (2Z)-2-hydroxyiminoacetyl chloride?
The InChIKey is KWFAKELABFNRJT-RJRFIUFISA-N. The full InChI is InChI=1S/C2H2ClNO2/c3-2(5)1-4-6/h1,6H/b4-1-.
What are the key properties of (2Z)-2-hydroxyiminoacetyl chloride?
(2Z)-2-hydroxyiminoacetyl chloride has a molecular weight of 107.50 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-hydroxyiminoacetyl chloride is sourced from PubChem (CID 175180486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).