About 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene
2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene (PubChem CID 175180869) has the molecular formula C34H36O2
and a molecular weight of 476.66 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene.
Molecular Properties
| Compound Name | 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene |
| PubChem CID | 175180869 |
| Molecular Formula | C34H36O2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene |
| SMILES | CCCCCCC(c1ccccc1)c1ccccc1.O=C1CC(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C19H24.C15H12O2/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h5-10,12-15,19H,2-4,11,16H2,1H3;1-9,15H,10H2 |
| InChIKey | KAWUWRJPTROFFY-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene?
The IUPAC name of 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene (CID 175180869) is 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene.
What is the SMILES notation for 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene?
The canonical SMILES for 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene is CCCCCCC(c1ccccc1)c1ccccc1.O=C1CC(c2ccccc2)Oc2ccccc21.
What is the InChIKey of 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene?
The InChIKey is KAWUWRJPTROFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24.C15H12O2/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h5-10,12-15,19H,2-4,11,16H2,1H3;1-9,15H,10H2.
What are the key properties of 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene?
2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene has a molecular weight of 476.66 g/mol, XLogP of 9.18, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2,3-dihydrochromen-4-one;1-phenylheptylbenzene is sourced from PubChem (CID 175180869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).