C6H2Cl5NaO2 — CID 175181919
sodium;hydride;1,2,3,4,5-pentachloro-6-hydroperoxybenzene (PubChem CID 175181919) has the molecular formula C6H2Cl5NaO2 and a molecular weight of 306.34 g/mol. Its IUPAC name is sodium;hydride;1,2,3,4,5-pentachloro-6-hydroperoxybenzene.
| Compound Name | sodium;hydride;1,2,3,4,5-pentachloro-6-hydroperoxybenzene |
|---|---|
| PubChem CID | 175181919 |
| Molecular Formula | C6H2Cl5NaO2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 303.84 |
| IUPAC Name | sodium;hydride;1,2,3,4,5-pentachloro-6-hydroperoxybenzene |
| SMILES | OOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[H-].[Na+] |
| InChI | InChI=1S/C6HCl5O2.Na.H/c7-1-2(8)4(10)6(13-12)5(11)3(1)9;;/h12H;;/q;+1;-1 |
| InChIKey | UJERJLJLAHHSIX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|