About oxacyclohexadecane-3,11-dione
oxacyclohexadecane-3,11-dione (PubChem CID 175181969) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is oxacyclohexadecane-3,11-dione.
Molecular Properties
| Compound Name | oxacyclohexadecane-3,11-dione |
| PubChem CID | 175181969 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | oxacyclohexadecane-3,11-dione |
| SMILES | O=C1CCCCCCCC(=O)COCCCCC1 |
| InChI | InChI=1S/C15H26O3/c16-14-9-5-2-1-3-6-11-15(17)13-18-12-8-4-7-10-14/h1-13H2 |
| InChIKey | YCTZNLNFZMZJMK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxacyclohexadecane-3,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxacyclohexadecane-3,11-dione?
The IUPAC name of oxacyclohexadecane-3,11-dione (CID 175181969) is oxacyclohexadecane-3,11-dione.
What is the SMILES notation for oxacyclohexadecane-3,11-dione?
The canonical SMILES for oxacyclohexadecane-3,11-dione is O=C1CCCCCCCC(=O)COCCCCC1.
What is the InChIKey of oxacyclohexadecane-3,11-dione?
The InChIKey is YCTZNLNFZMZJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c16-14-9-5-2-1-3-6-11-15(17)13-18-12-8-4-7-10-14/h1-13H2.
What are the key properties of oxacyclohexadecane-3,11-dione?
oxacyclohexadecane-3,11-dione has a molecular weight of 254.37 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxacyclohexadecane-3,11-dione is sourced from PubChem (CID 175181969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).