C39H60N8O3Zn — CID 175182498
4-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-6-yloxy)benzoic acid;zinc (PubChem CID 175182498) has the molecular formula C39H60N8O3Zn and a molecular weight of 754.35 g/mol. Its IUPAC name is 4-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-6-yloxy)benzoic acid;zinc.
| Compound Name | 4-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-6-yloxy)benzoic acid;zinc |
|---|---|
| PubChem CID | 175182498 |
| Molecular Formula | C39H60N8O3Zn |
| Molecular Weight | 754.35 g/mol |
| Exact Mass | 752.41 |
| IUPAC Name | 4-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-6-yloxy)benzoic acid;zinc |
| SMILES | O=C(O)c1ccc(OC2CCC3C4NC5NC(NC6NC(NC7NC(NC(N4)C3C2)C2CCCCC72)C2CCCCC62)C2CCCCC52)cc1.[Zn] |
| InChI | InChI=1S/C39H60N8O3.Zn/c48-39(49)20-13-15-21(16-14-20)50-22-17-18-29-30(19-22)38-46-36-28-12-6-5-11-27(28)34(44-36)42-32-24-8-2-1-7-23(24)31(40-32)41-33-25-9-3-4-10-26(25)35(43-33)45-37(29)47-38;/h13-16,22-38,40-47H,1-12,17-19H2,(H,48,49); |
| InChIKey | NUULUKYXCLSQTL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|