About 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol
2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol (PubChem CID 175183046) has the molecular formula C20H23FN2O4
and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol.
Molecular Properties
| Compound Name | 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol |
| PubChem CID | 175183046 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol |
| SMILES | COc1cccc(F)c1O.Cc1ccc2c(cnn2C2CCCCO2)c1O |
| InChI | InChI=1S/C13H16N2O2.C7H7FO2/c1-9-5-6-11-10(13(9)16)8-14-15(11)12-4-2-3-7-17-12;1-10-6-4-2-3-5(8)7(6)9/h5-6,8,12,16H,2-4,7H2,1H3;2-4,9H,1H3 |
| InChIKey | PBMFUEIRDQONMQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol?
The IUPAC name of 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol (CID 175183046) is 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol.
What is the SMILES notation for 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol?
The canonical SMILES for 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol is COc1cccc(F)c1O.Cc1ccc2c(cnn2C2CCCCO2)c1O.
What is the InChIKey of 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol?
The InChIKey is PBMFUEIRDQONMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2.C7H7FO2/c1-9-5-6-11-10(13(9)16)8-14-15(11)12-4-2-3-7-17-12;1-10-6-4-2-3-5(8)7(6)9/h5-6,8,12,16H,2-4,7H2,1H3;2-4,9H,1H3.
What are the key properties of 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol?
2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol has a molecular weight of 374.41 g/mol, XLogP of 4.29, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-methoxyphenol;5-methyl-1-(oxan-2-yl)indazol-4-ol is sourced from PubChem (CID 175183046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).