C10H13ClN4O3 — CID 175183971
[(3S,4S)-1-(5-chloropyrazin-2-yl)-3-hydroxypiperidin-4-yl] carbamate (PubChem CID 175183971) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is [(3S,4S)-1-(5-chloropyrazin-2-yl)-3-hydroxypiperidin-4-yl] carbamate.
| Compound Name | [(3S,4S)-1-(5-chloropyrazin-2-yl)-3-hydroxypiperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175183971 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | [(3S,4S)-1-(5-chloropyrazin-2-yl)-3-hydroxypiperidin-4-yl] carbamate |
| SMILES | NC(=O)O[C@H]1CCN(c2cnc(Cl)cn2)C[C@@H]1O |
| InChI | InChI=1S/C10H13ClN4O3/c11-8-3-14-9(4-13-8)15-2-1-7(6(16)5-15)18-10(12)17/h3-4,6-7,16H,1-2,5H2,(H2,12,17)/t6-,7-/m0/s1 |
| InChIKey | XMKXURNLCIPKPA-BQBZGAKWSA-N |
| XLogP | 0.16 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |