About 5-methyl-1-oxidoindole
5-methyl-1-oxidoindole (PubChem CID 175184350) has the molecular formula C9H8NO-
and a molecular weight of 146.17 g/mol. Its IUPAC name is 5-methyl-1-oxidoindole.
Molecular Properties
| Compound Name | 5-methyl-1-oxidoindole |
| PubChem CID | 175184350 |
| Molecular Formula | C9H8NO- |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 5-methyl-1-oxidoindole |
| SMILES | Cc1ccc2c(ccn2[O-])c1 |
| InChI | InChI=1S/C9H8NO/c1-7-2-3-9-8(6-7)4-5-10(9)11/h2-6H,1H3/q-1 |
| InChIKey | IDWKUEASZCYXJI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1-oxidoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-oxidoindole?
The IUPAC name of 5-methyl-1-oxidoindole (CID 175184350) is 5-methyl-1-oxidoindole.
What is the SMILES notation for 5-methyl-1-oxidoindole?
The canonical SMILES for 5-methyl-1-oxidoindole is Cc1ccc2c(ccn2[O-])c1.
What is the InChIKey of 5-methyl-1-oxidoindole?
The InChIKey is IDWKUEASZCYXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8NO/c1-7-2-3-9-8(6-7)4-5-10(9)11/h2-6H,1H3/q-1.
What are the key properties of 5-methyl-1-oxidoindole?
5-methyl-1-oxidoindole has a molecular weight of 146.17 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-oxidoindole is sourced from PubChem (CID 175184350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).