C12H23N — CID 175184954
N,N,2,4,4-pentamethyl-3-methylidenehex-5-en-2-amine (PubChem CID 175184954) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N,N,2,4,4-pentamethyl-3-methylidenehex-5-en-2-amine.
| Compound Name | N,N,2,4,4-pentamethyl-3-methylidenehex-5-en-2-amine |
|---|---|
| PubChem CID | 175184954 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N,N,2,4,4-pentamethyl-3-methylidenehex-5-en-2-amine |
| SMILES | C=CC(C)(C)C(=C)C(C)(C)N(C)C |
| InChI | InChI=1S/C12H23N/c1-9-11(3,4)10(2)12(5,6)13(7)8/h9H,1-2H2,3-8H3 |
| InChIKey | AGFUPXPFKYKLBC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|