C26H19F2NO7 — CID 175185040
4-[2-[3-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]phenyl]oxiran-2-yl]benzoic acid (PubChem CID 175185040) has the molecular formula C26H19F2NO7 and a molecular weight of 495.43 g/mol. Its IUPAC name is 4-[2-[3-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]phenyl]oxiran-2-yl]benzoic acid.
| Compound Name | 4-[2-[3-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]phenyl]oxiran-2-yl]benzoic acid |
|---|---|
| PubChem CID | 175185040 |
| Molecular Formula | C26H19F2NO7 |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 4-[2-[3-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]phenyl]oxiran-2-yl]benzoic acid |
| SMILES | C[C@]1(C(=O)Nc2cccc(C3(c4ccc(C(=O)O)cc4)CO3)c2)COc2cc3c(cc21)OC(F)(F)O3 |
| InChI | InChI=1S/C26H19F2NO7/c1-24(12-33-19-11-21-20(10-18(19)24)35-26(27,28)36-21)23(32)29-17-4-2-3-16(9-17)25(13-34-25)15-7-5-14(6-8-15)22(30)31/h2-11H,12-13H2,1H3,(H,29,32)(H,30,31)/t24-,25?/m0/s1 |
| InChIKey | WESBTFCSEBRPCQ-SKCDSABHSA-N |
| XLogP | 4.27 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|