About sodium;carbamothioyl butane-1-sulfonate;hydride
sodium;carbamothioyl butane-1-sulfonate;hydride (PubChem CID 175185820) has the molecular formula C5H12NNaO3S2
and a molecular weight of 221.28 g/mol. Its IUPAC name is sodium;carbamothioyl butane-1-sulfonate;hydride.
Molecular Properties
| Compound Name | sodium;carbamothioyl butane-1-sulfonate;hydride |
| PubChem CID | 175185820 |
| Molecular Formula | C5H12NNaO3S2 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | sodium;carbamothioyl butane-1-sulfonate;hydride |
| SMILES | CCCCS(=O)(=O)OC(N)=S.[H-].[Na+] |
| InChI | InChI=1S/C5H11NO3S2.Na.H/c1-2-3-4-11(7,8)9-5(6)10;;/h2-4H2,1H3,(H2,6,10);;/q;+1;-1 |
| InChIKey | LGGNIJBPQQZCDV-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;carbamothioyl butane-1-sulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;carbamothioyl butane-1-sulfonate;hydride?
The IUPAC name of sodium;carbamothioyl butane-1-sulfonate;hydride (CID 175185820) is sodium;carbamothioyl butane-1-sulfonate;hydride.
What is the SMILES notation for sodium;carbamothioyl butane-1-sulfonate;hydride?
The canonical SMILES for sodium;carbamothioyl butane-1-sulfonate;hydride is CCCCS(=O)(=O)OC(N)=S.[H-].[Na+].
What is the InChIKey of sodium;carbamothioyl butane-1-sulfonate;hydride?
The InChIKey is LGGNIJBPQQZCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3S2.Na.H/c1-2-3-4-11(7,8)9-5(6)10;;/h2-4H2,1H3,(H2,6,10);;/q;+1;-1.
What are the key properties of sodium;carbamothioyl butane-1-sulfonate;hydride?
sodium;carbamothioyl butane-1-sulfonate;hydride has a molecular weight of 221.28 g/mol, XLogP of -2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;carbamothioyl butane-1-sulfonate;hydride is sourced from PubChem (CID 175185820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).