About azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride
azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride (PubChem CID 175185911) has the molecular formula C14H24ClN
and a molecular weight of 241.81 g/mol. Its IUPAC name is azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride.
Molecular Properties
| Compound Name | azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride |
| PubChem CID | 175185911 |
| Molecular Formula | C14H24ClN |
| Molecular Weight | 241.81 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride |
| SMILES | C=Cc1ccc(CC)c(CC)c1CC.Cl.N |
| InChI | InChI=1S/C14H20.ClH.H3N/c1-5-11-9-10-12(6-2)14(8-4)13(11)7-3;;/h5,9-10H,1,6-8H2,2-4H3;1H;1H3 |
| InChIKey | RODQQLMDUFJTFD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride?
The IUPAC name of azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride (CID 175185911) is azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride.
What is the SMILES notation for azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride?
The canonical SMILES for azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride is C=Cc1ccc(CC)c(CC)c1CC.Cl.N.
What is the InChIKey of azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride?
The InChIKey is RODQQLMDUFJTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20.ClH.H3N/c1-5-11-9-10-12(6-2)14(8-4)13(11)7-3;;/h5,9-10H,1,6-8H2,2-4H3;1H;1H3.
What are the key properties of azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride?
azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride has a molecular weight of 241.81 g/mol, XLogP of 4.60, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethenyl-2,3,4-triethylbenzene;hydrochloride is sourced from PubChem (CID 175185911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).