About 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride
7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride (PubChem CID 175186204) has the molecular formula C6H7ClN4
and a molecular weight of 170.60 g/mol. Its IUPAC name is 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 175186204 |
| Molecular Formula | C6H7ClN4 |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride |
| SMILES | Cl.Nc1ncnc2c1C=NC2 |
| InChI | InChI=1S/C6H6N4.ClH/c7-6-4-1-8-2-5(4)9-3-10-6;/h1,3H,2H2,(H2,7,9,10);1H |
| InChIKey | URRCSCASFOQDRG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride (CID 175186204) is 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride is Cl.Nc1ncnc2c1C=NC2.
What is the InChIKey of 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is URRCSCASFOQDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.ClH/c7-6-4-1-8-2-5(4)9-3-10-6;/h1,3H,2H2,(H2,7,9,10);1H.
What are the key properties of 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride?
7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 170.60 g/mol, XLogP of 0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[3,4-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 175186204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).