About 2-(1,2,2-trichloroethoxy)acetic acid
2-(1,2,2-trichloroethoxy)acetic acid (PubChem CID 175187287) has the molecular formula C4H5Cl3O3
and a molecular weight of 207.44 g/mol. Its IUPAC name is 2-(1,2,2-trichloroethoxy)acetic acid.
Molecular Properties
| Compound Name | 2-(1,2,2-trichloroethoxy)acetic acid |
| PubChem CID | 175187287 |
| Molecular Formula | C4H5Cl3O3 |
| Molecular Weight | 207.44 g/mol |
| Exact Mass | 205.93 |
| IUPAC Name | 2-(1,2,2-trichloroethoxy)acetic acid |
| SMILES | O=C(O)COC(Cl)C(Cl)Cl |
| InChI | InChI=1S/C4H5Cl3O3/c5-3(6)4(7)10-1-2(8)9/h3-4H,1H2,(H,8,9) |
| InChIKey | ZVPRAXRKYURAJH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2,2-trichloroethoxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,2-trichloroethoxy)acetic acid?
The IUPAC name of 2-(1,2,2-trichloroethoxy)acetic acid (CID 175187287) is 2-(1,2,2-trichloroethoxy)acetic acid.
What is the SMILES notation for 2-(1,2,2-trichloroethoxy)acetic acid?
The canonical SMILES for 2-(1,2,2-trichloroethoxy)acetic acid is O=C(O)COC(Cl)C(Cl)Cl.
What is the InChIKey of 2-(1,2,2-trichloroethoxy)acetic acid?
The InChIKey is ZVPRAXRKYURAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5Cl3O3/c5-3(6)4(7)10-1-2(8)9/h3-4H,1H2,(H,8,9).
What are the key properties of 2-(1,2,2-trichloroethoxy)acetic acid?
2-(1,2,2-trichloroethoxy)acetic acid has a molecular weight of 207.44 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,2-trichloroethoxy)acetic acid is sourced from PubChem (CID 175187287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).