About 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile
5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile (PubChem CID 175187388) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile |
| PubChem CID | 175187388 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(C2=CCNCC2)s1 |
| InChI | InChI=1S/C10H10N2S/c11-7-9-1-2-10(13-9)8-3-5-12-6-4-8/h1-3,12H,4-6H2 |
| InChIKey | JKZSBCYPLARKMM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile?
The IUPAC name of 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile (CID 175187388) is 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile.
What is the SMILES notation for 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile?
The canonical SMILES for 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile is N#Cc1ccc(C2=CCNCC2)s1.
What is the InChIKey of 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile?
The InChIKey is JKZSBCYPLARKMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c11-7-9-1-2-10(13-9)8-3-5-12-6-4-8/h1-3,12H,4-6H2.
What are the key properties of 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile?
5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile has a molecular weight of 190.27 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carbonitrile is sourced from PubChem (CID 175187388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).