About triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate
triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate (PubChem CID 175187428) has the molecular formula C20H20FNO7
and a molecular weight of 405.38 g/mol. Its IUPAC name is triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate.
Molecular Properties
| Compound Name | triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate |
| PubChem CID | 175187428 |
| Molecular Formula | C20H20FNO7 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)cc2)c(C(=O)OCC)c(C(=O)OCC)c1=O |
| InChI | InChI=1S/C20H20FNO7/c1-4-27-18(24)14-11-22(13-9-7-12(21)8-10-13)16(20(26)29-6-3)15(17(14)23)19(25)28-5-2/h7-11H,4-6H2,1-3H3 |
| InChIKey | IDOYIAHSSTWXMY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate?
The IUPAC name of triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate (CID 175187428) is triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate.
What is the SMILES notation for triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate?
The canonical SMILES for triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate is CCOC(=O)c1cn(-c2ccc(F)cc2)c(C(=O)OCC)c(C(=O)OCC)c1=O.
What is the InChIKey of triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate?
The InChIKey is IDOYIAHSSTWXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FNO7/c1-4-27-18(24)14-11-22(13-9-7-12(21)8-10-13)16(20(26)29-6-3)15(17(14)23)19(25)28-5-2/h7-11H,4-6H2,1-3H3.
What are the key properties of triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate?
triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate has a molecular weight of 405.38 g/mol, XLogP of 2.51, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl 1-(4-fluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate is sourced from PubChem (CID 175187428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).