About 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione
6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione (PubChem CID 175187827) has the molecular formula C19H16O5
and a molecular weight of 324.33 g/mol. Its IUPAC name is 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione.
Molecular Properties
| Compound Name | 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione |
| PubChem CID | 175187827 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione |
| SMILES | C=C(O)c1cc2c(cc1OC)C(=O)c1c(ccc(OC)c1C)C2=O |
| InChI | InChI=1S/C19H16O5/c1-9-15(23-3)6-5-11-17(9)19(22)14-8-16(24-4)12(10(2)20)7-13(14)18(11)21/h5-8,20H,2H2,1,3-4H3 |
| InChIKey | CVEQYVJXFUALJT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione?
The IUPAC name of 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione (CID 175187827) is 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione.
What is the SMILES notation for 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione?
The canonical SMILES for 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione is C=C(O)c1cc2c(cc1OC)C(=O)c1c(ccc(OC)c1C)C2=O.
What is the InChIKey of 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione?
The InChIKey is CVEQYVJXFUALJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O5/c1-9-15(23-3)6-5-11-17(9)19(22)14-8-16(24-4)12(10(2)20)7-13(14)18(11)21/h5-8,20H,2H2,1,3-4H3.
What are the key properties of 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione?
6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione has a molecular weight of 324.33 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-hydroxyethenyl)-2,7-dimethoxy-1-methylanthracene-9,10-dione is sourced from PubChem (CID 175187827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).