About 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine
2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine (PubChem CID 175187842) has the molecular formula C16H17ClFN3OS
and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
| PubChem CID | 175187842 |
| Molecular Formula | C16H17ClFN3OS |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c(CC(N)CF)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C16H17ClFN3OS/c1-9-13(5-10(19)7-18)23-16-12(6-14(17)21-15(9)16)20-8-11-3-2-4-22-11/h2-4,6,10H,5,7-8,19H2,1H3,(H,20,21) |
| InChIKey | YXXNDNGTDPLIMF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine?
The IUPAC name of 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine (CID 175187842) is 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine?
The canonical SMILES for 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine is Cc1c(CC(N)CF)sc2c(NCc3ccco3)cc(Cl)nc12.
What is the InChIKey of 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine?
The InChIKey is YXXNDNGTDPLIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClFN3OS/c1-9-13(5-10(19)7-18)23-16-12(6-14(17)21-15(9)16)20-8-11-3-2-4-22-11/h2-4,6,10H,5,7-8,19H2,1H3,(H,20,21).
What are the key properties of 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine?
2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine has a molecular weight of 353.85 g/mol, XLogP of 4.30, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-3-fluoropropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 175187842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).