About [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane
[2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane (PubChem CID 175187895) has the molecular formula C11H18OSi
and a molecular weight of 194.35 g/mol. Its IUPAC name is [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane.
Molecular Properties
| Compound Name | [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane |
| PubChem CID | 175187895 |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane |
| SMILES | [SiH3]C1(CC2C=CC=C2)CCCCO1 |
| InChI | InChI=1S/C11H18OSi/c13-11(7-3-4-8-12-11)9-10-5-1-2-6-10/h1-2,5-6,10H,3-4,7-9H2,13H3 |
| InChIKey | OSGZMSUEKPWJNW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane?
The IUPAC name of [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane (CID 175187895) is [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane.
What is the SMILES notation for [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane?
The canonical SMILES for [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane is [SiH3]C1(CC2C=CC=C2)CCCCO1.
What is the InChIKey of [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane?
The InChIKey is OSGZMSUEKPWJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OSi/c13-11(7-3-4-8-12-11)9-10-5-1-2-6-10/h1-2,5-6,10H,3-4,7-9H2,13H3.
What are the key properties of [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane?
[2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane has a molecular weight of 194.35 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopenta-2,4-dien-1-ylmethyl)oxan-2-yl]silane is sourced from PubChem (CID 175187895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).