C19H22F2O — CID 175188741
5-ethoxy-1,6-difluoro-5-[(E)-pent-3-enyl]-2-phenylcyclohexa-1,3-diene (PubChem CID 175188741) has the molecular formula C19H22F2O and a molecular weight of 304.38 g/mol. Its IUPAC name is 5-ethoxy-1,6-difluoro-5-[(E)-pent-3-enyl]-2-phenylcyclohexa-1,3-diene.
| Compound Name | 5-ethoxy-1,6-difluoro-5-[(E)-pent-3-enyl]-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175188741 |
| Molecular Formula | C19H22F2O |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 5-ethoxy-1,6-difluoro-5-[(E)-pent-3-enyl]-2-phenylcyclohexa-1,3-diene |
| SMILES | C/C=C/CCC1(OCC)C=CC(c2ccccc2)=C(F)C1F |
| InChI | InChI=1S/C19H22F2O/c1-3-5-9-13-19(22-4-2)14-12-16(17(20)18(19)21)15-10-7-6-8-11-15/h3,5-8,10-12,14,18H,4,9,13H2,1-2H3/b5-3+ |
| InChIKey | SJPONEDCTXOTCD-HWKANZROSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|