C26H22BrN3O2 — CID 175188875
(6aS,7S,10aR)-2-(5-bromo-2-hydroxyphenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 175188875) has the molecular formula C26H22BrN3O2 and a molecular weight of 488.39 g/mol. Its IUPAC name is (6aS,7S,10aR)-2-(5-bromo-2-hydroxyphenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aS,7S,10aR)-2-(5-bromo-2-hydroxyphenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 175188875 |
| Molecular Formula | C26H22BrN3O2 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (6aS,7S,10aR)-2-(5-bromo-2-hydroxyphenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)C[C@@]2(c3ccccc3)c3nc(-c4cc(Br)ccc4O)ncc3CC[C@@H]12 |
| InChI | InChI=1S/C26H22BrN3O2/c1-15-21-9-7-16-14-29-25(20-11-19(27)8-10-22(20)31)30-24(16)26(21,12-17(13-28)23(15)32)18-5-3-2-4-6-18/h2-6,8,10-11,14-15,17,21,31H,7,9,12H2,1H3/t15-,17?,21-,26-/m0/s1 |
| InChIKey | QMGQOAVKGISYAH-KJIGLPNDSA-N |
| XLogP | 5.21 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|