C22H21Cl2N3O2 — CID 175188897
N-[[6-[3-(3-amino-2-chlorophenyl)-2-chlorophenyl]-2-methoxy-3-pyridinyl]methyl]oxetan-3-amine (PubChem CID 175188897) has the molecular formula C22H21Cl2N3O2 and a molecular weight of 430.34 g/mol. Its IUPAC name is N-[[6-[3-(3-amino-2-chlorophenyl)-2-chlorophenyl]-2-methoxy-3-pyridinyl]methyl]oxetan-3-amine.
| Compound Name | N-[[6-[3-(3-amino-2-chlorophenyl)-2-chlorophenyl]-2-methoxy-3-pyridinyl]methyl]oxetan-3-amine |
|---|---|
| PubChem CID | 175188897 |
| Molecular Formula | C22H21Cl2N3O2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-[[6-[3-(3-amino-2-chlorophenyl)-2-chlorophenyl]-2-methoxy-3-pyridinyl]methyl]oxetan-3-amine |
| SMILES | COc1nc(-c2cccc(-c3cccc(N)c3Cl)c2Cl)ccc1CNC1COC1 |
| InChI | InChI=1S/C22H21Cl2N3O2/c1-28-22-13(10-26-14-11-29-12-14)8-9-19(27-22)17-6-2-4-15(20(17)23)16-5-3-7-18(25)21(16)24/h2-9,14,26H,10-12,25H2,1H3 |
| InChIKey | XHKJOUOGBLCMTN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|