About cyclopenta-1,3-diene;indigane;triethylgermane
cyclopenta-1,3-diene;indigane;triethylgermane (PubChem CID 175188989) has the molecular formula C11H25GeIn
and a molecular weight of 344.75 g/mol. Its IUPAC name is cyclopenta-1,3-diene;indigane;triethylgermane.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;indigane;triethylgermane |
| PubChem CID | 175188989 |
| Molecular Formula | C11H25GeIn |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | cyclopenta-1,3-diene;indigane;triethylgermane |
| SMILES | C1=CCC=C1.CC[GeH](CC)CC.[InH3] |
| InChI | InChI=1S/C6H16Ge.C5H6.In.3H/c1-4-7(5-2)6-3;1-2-4-5-3-1;;;;/h7H,4-6H2,1-3H3;1-4H,5H2;;;; |
| InChIKey | DFKWTVPLXVLWBK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopenta-1,3-diene;indigane;triethylgermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;indigane;triethylgermane?
The IUPAC name of cyclopenta-1,3-diene;indigane;triethylgermane (CID 175188989) is cyclopenta-1,3-diene;indigane;triethylgermane.
What is the SMILES notation for cyclopenta-1,3-diene;indigane;triethylgermane?
The canonical SMILES for cyclopenta-1,3-diene;indigane;triethylgermane is C1=CCC=C1.CC[GeH](CC)CC.[InH3].
What is the InChIKey of cyclopenta-1,3-diene;indigane;triethylgermane?
The InChIKey is DFKWTVPLXVLWBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16Ge.C5H6.In.3H/c1-4-7(5-2)6-3;1-2-4-5-3-1;;;;/h7H,4-6H2,1-3H3;1-4H,5H2;;;;.
What are the key properties of cyclopenta-1,3-diene;indigane;triethylgermane?
cyclopenta-1,3-diene;indigane;triethylgermane has a molecular weight of 344.75 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;indigane;triethylgermane is sourced from PubChem (CID 175188989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).