C37H47N9O3 — CID 175189048
ethyl 7-[4-[4-[[8-anilino-9-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate (PubChem CID 175189048) has the molecular formula C37H47N9O3 and a molecular weight of 665.84 g/mol. Its IUPAC name is ethyl 7-[4-[4-[[8-anilino-9-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate.
| Compound Name | ethyl 7-[4-[4-[[8-anilino-9-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate |
|---|---|
| PubChem CID | 175189048 |
| Molecular Formula | C37H47N9O3 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.38 |
| IUPAC Name | ethyl 7-[4-[4-[[8-anilino-9-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]purin-2-yl]amino]phenyl]piperazin-1-yl]heptanoate |
| SMILES | C=CC(=O)N1CC[C@H](n2c(Nc3ccccc3)nc3cnc(Nc4ccc(N5CCN(CCCCCCC(=O)OCC)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C37H47N9O3/c1-3-33(47)45-21-19-31(27-45)46-35-32(41-37(46)40-28-12-8-7-9-13-28)26-38-36(42-35)39-29-15-17-30(18-16-29)44-24-22-43(23-25-44)20-11-6-5-10-14-34(48)49-4-2/h3,7-9,12-13,15-18,26,31H,1,4-6,10-11,14,19-25,27H2,2H3,(H,40,41)(H,38,39,42)/t31-/m0/s1 |
| InChIKey | HSSKEEHLRRTLLW-HKBQPEDESA-N |
| XLogP | 5.91 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|