C21H26F2N4O4S — CID 175189314
2-(4-methylphenyl)ethylsulfonyl (4R)-3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 175189314) has the molecular formula C21H26F2N4O4S and a molecular weight of 468.53 g/mol. Its IUPAC name is 2-(4-methylphenyl)ethylsulfonyl (4R)-3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | 2-(4-methylphenyl)ethylsulfonyl (4R)-3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175189314 |
| Molecular Formula | C21H26F2N4O4S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-(4-methylphenyl)ethylsulfonyl (4R)-3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(CCS(=O)(=O)OC(=O)N2CC[C@H](CNc3cnc(C)cn3)C(F)(F)C2)cc1 |
| InChI | InChI=1S/C21H26F2N4O4S/c1-15-3-5-17(6-4-15)8-10-32(29,30)31-20(28)27-9-7-18(21(22,23)14-27)12-26-19-13-24-16(2)11-25-19/h3-6,11,13,18H,7-10,12,14H2,1-2H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | PWCCPQYSMURVDR-GOSISDBHSA-N |
| XLogP | 3.17 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|