C27H33IN4O4 — CID 175189517
[2-[[3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoylamino]phenyl] N-tert-butylcarbamate (PubChem CID 175189517) has the molecular formula C27H33IN4O4 and a molecular weight of 604.49 g/mol. Its IUPAC name is [2-[[3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoylamino]phenyl] N-tert-butylcarbamate.
| Compound Name | [2-[[3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoylamino]phenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175189517 |
| Molecular Formula | C27H33IN4O4 |
| Molecular Weight | 604.49 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | [2-[[3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl]carbamoylamino]phenyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1ccccc1NC(=O)NC1C(C)(C)C(Oc2ccc(C#N)c(I)c2)C1(C)C |
| InChI | InChI=1S/C27H33IN4O4/c1-25(2,3)32-24(34)36-20-11-9-8-10-19(20)30-23(33)31-21-26(4,5)22(27(21,6)7)35-17-13-12-16(15-29)18(28)14-17/h8-14,21-22H,1-7H3,(H,32,34)(H2,30,31,33) |
| InChIKey | KSOCAEAYARSLBT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|