C27H23F3N4O2 — CID 175189975
1-[2-[1-[2-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]indol-6-yl]ethynyl]cyclohexan-1-ol (PubChem CID 175189975) has the molecular formula C27H23F3N4O2 and a molecular weight of 492.50 g/mol. Its IUPAC name is 1-[2-[1-[2-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]indol-6-yl]ethynyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[1-[2-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]indol-6-yl]ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 175189975 |
| Molecular Formula | C27H23F3N4O2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 1-[2-[1-[2-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]indol-6-yl]ethynyl]cyclohexan-1-ol |
| SMILES | OC1(C#Cc2ccc3ccn(-c4ccnc(Nc5ccc(OC(F)(F)F)cc5)n4)c3c2)CCCCC1 |
| InChI | InChI=1S/C27H23F3N4O2/c28-27(29,30)36-22-8-6-21(7-9-22)32-25-31-16-11-24(33-25)34-17-12-20-5-4-19(18-23(20)34)10-15-26(35)13-2-1-3-14-26/h4-9,11-12,16-18,35H,1-3,13-14H2,(H,31,32,33) |
| InChIKey | OEHJERMQYVRMFQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|