About 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene
3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene (PubChem CID 175190379) has the molecular formula C12H10F2
and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene |
| PubChem CID | 175190379 |
| Molecular Formula | C12H10F2 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene |
| SMILES | C=CC=Cc1c(F)ccc(C=C)c1F |
| InChI | InChI=1S/C12H10F2/c1-3-5-6-10-11(13)8-7-9(4-2)12(10)14/h3-8H,1-2H2 |
| InChIKey | CRIWHWQKOFQUTN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene?
The IUPAC name of 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene (CID 175190379) is 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene.
What is the SMILES notation for 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene?
The canonical SMILES for 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene is C=CC=Cc1c(F)ccc(C=C)c1F.
What is the InChIKey of 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene?
The InChIKey is CRIWHWQKOFQUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2/c1-3-5-6-10-11(13)8-7-9(4-2)12(10)14/h3-8H,1-2H2.
What are the key properties of 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene?
3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene has a molecular weight of 192.21 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-buta-1,3-dienyl-1-ethenyl-2,4-difluorobenzene is sourced from PubChem (CID 175190379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).