C9H8F3NO5S2 — CID 175190741
(1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazin-6-yl) trifluoromethanesulfonate (PubChem CID 175190741) has the molecular formula C9H8F3NO5S2 and a molecular weight of 331.29 g/mol. Its IUPAC name is (1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazin-6-yl) trifluoromethanesulfonate.
| Compound Name | (1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazin-6-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175190741 |
| Molecular Formula | C9H8F3NO5S2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | (1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazin-6-yl) trifluoromethanesulfonate |
| SMILES | O=S1(=O)NCCc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C9H8F3NO5S2/c10-9(11,12)20(16,17)18-7-1-2-8-6(5-7)3-4-13-19(8,14)15/h1-2,5,13H,3-4H2 |
| InChIKey | YHIAZZKCAUIFQE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|